C15H19N3O2 — CID 126514802
methyl 4-cyclobutyl-5-(2-iminoethanehydrazonoyl)-2-methylbenzoate (PubChem CID 126514802) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is methyl 4-cyclobutyl-5-(2-iminoethanehydrazonoyl)-2-methylbenzoate.
| Compound Name | methyl 4-cyclobutyl-5-(2-iminoethanehydrazonoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 126514802 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | methyl 4-cyclobutyl-5-(2-iminoethanehydrazonoyl)-2-methylbenzoate |
| SMILES | [H]/N=C/C(=N\N)c1cc(C(=O)OC)c(C)cc1C1CCC1 |
| InChI | InChI=1S/C15H19N3O2/c1-9-6-12(10-4-3-5-10)13(14(8-16)18-17)7-11(9)15(19)20-2/h6-8,10,16H,3-5,17H2,1-2H3/b16-8+,18-14+ |
| InChIKey | UXSHZHPYQYDJJQ-HVFIVSQRSA-N |
| XLogP | 2.36 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|