C16H21BO4 — CID 123333353
methyl 4-cyclopropyl-5-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-2-methylbenzoate (PubChem CID 123333353) has the molecular formula C16H21BO4 and a molecular weight of 288.15 g/mol. Its IUPAC name is methyl 4-cyclopropyl-5-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-2-methylbenzoate.
| Compound Name | methyl 4-cyclopropyl-5-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-2-methylbenzoate |
|---|---|
| PubChem CID | 123333353 |
| Molecular Formula | C16H21BO4 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | methyl 4-cyclopropyl-5-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-2-methylbenzoate |
| SMILES | COC(=O)c1cc(B2OCC(C)(C)O2)c(C2CC2)cc1C |
| InChI | InChI=1S/C16H21BO4/c1-10-7-13(11-5-6-11)14(8-12(10)15(18)19-4)17-20-9-16(2,3)21-17/h7-8,11H,5-6,9H2,1-4H3 |
| InChIKey | ATJVZONDHJJBSJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|