C29H44N2O10 — CID 162141266
diethoxymethoxyethane;ethyl 6-(diethoxymethyl)pyridine-2-carboxylate;ethyl 6-formylpyridine-2-carboxylate (PubChem CID 162141266) has the molecular formula C29H44N2O10 and a molecular weight of 580.68 g/mol. Its IUPAC name is diethoxymethoxyethane;ethyl 6-(diethoxymethyl)pyridine-2-carboxylate;ethyl 6-formylpyridine-2-carboxylate.
| Compound Name | diethoxymethoxyethane;ethyl 6-(diethoxymethyl)pyridine-2-carboxylate;ethyl 6-formylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 162141266 |
| Molecular Formula | C29H44N2O10 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | diethoxymethoxyethane;ethyl 6-(diethoxymethyl)pyridine-2-carboxylate;ethyl 6-formylpyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(C(OCC)OCC)n1.CCOC(=O)c1cccc(C=O)n1.CCOC(OCC)OCC |
| InChI | InChI=1S/C13H19NO4.C9H9NO3.C7H16O3/c1-4-16-12(15)10-8-7-9-11(14-10)13(17-5-2)18-6-3;1-2-13-9(12)8-5-3-4-7(6-11)10-8;1-4-8-7(9-5-2)10-6-3/h7-9,13H,4-6H2,1-3H3;3-6H,2H2,1H3;7H,4-6H2,1-3H3 |
| InChIKey | ZJYLYRBFNRGOEZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 141.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|