C11H13N — CID 162141409
4,5,6-trimethyl-5H-cyclopenta[b]pyridine (PubChem CID 162141409) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 4,5,6-trimethyl-5H-cyclopenta[b]pyridine.
| Compound Name | 4,5,6-trimethyl-5H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 162141409 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 4,5,6-trimethyl-5H-cyclopenta[b]pyridine |
| SMILES | CC1=Cc2nccc(C)c2C1C |
| InChI | InChI=1S/C11H13N/c1-7-4-5-12-10-6-8(2)9(3)11(7)10/h4-6,9H,1-3H3 |
| InChIKey | TXRQFTAFQOUQTB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |