About 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde
2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde (PubChem CID 162147311) has the molecular formula C17H20N2O8S
and a molecular weight of 412.42 g/mol. Its IUPAC name is 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde |
| PubChem CID | 162147311 |
| Molecular Formula | C17H20N2O8S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde |
| SMILES | CS(=O)(=O)OCCOc1ccc(C=O)cn1.O=Cc1ccc(OCCO)nc1 |
| InChI | InChI=1S/C9H11NO5S.C8H9NO3/c1-16(12,13)15-5-4-14-9-3-2-8(7-11)6-10-9;10-3-4-12-8-2-1-7(6-11)5-9-8/h2-3,6-7H,4-5H2,1H3;1-2,5-6,10H,3-4H2 |
| InChIKey | ZKSPZHGNRWNQDF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 141.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde?
The IUPAC name of 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde (CID 162147311) is 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde.
What is the SMILES notation for 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde?
The canonical SMILES for 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde is CS(=O)(=O)OCCOc1ccc(C=O)cn1.O=Cc1ccc(OCCO)nc1.
What is the InChIKey of 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde?
The InChIKey is ZKSPZHGNRWNQDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO5S.C8H9NO3/c1-16(12,13)15-5-4-14-9-3-2-8(7-11)6-10-9;10-3-4-12-8-2-1-7(6-11)5-9-8/h2-3,6-7H,4-5H2,1H3;1-2,5-6,10H,3-4H2.
What are the key properties of 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde?
2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde has a molecular weight of 412.42 g/mol, XLogP of 0.51, 10 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-formyl-2-pyridinyl)oxy]ethyl methanesulfonate;6-(2-hydroxyethoxy)pyridine-3-carbaldehyde is sourced from PubChem (CID 162147311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).