C24H34BBrN4O4 — CID 162148265
4-(5-bromo-2-pyridinyl)morpholine;4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine (PubChem CID 162148265) has the molecular formula C24H34BBrN4O4 and a molecular weight of 533.28 g/mol. Its IUPAC name is 4-(5-bromo-2-pyridinyl)morpholine;4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine.
| Compound Name | 4-(5-bromo-2-pyridinyl)morpholine;4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 162148265 |
| Molecular Formula | C24H34BBrN4O4 |
| Molecular Weight | 533.28 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 4-(5-bromo-2-pyridinyl)morpholine;4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine |
| SMILES | Brc1ccc(N2CCOCC2)nc1.CC1(C)OB(c2ccc(N3CCOCC3)nc2)OC1(C)C |
| InChI | InChI=1S/C15H23BN2O3.C9H11BrN2O/c1-14(2)15(3,4)21-16(20-14)12-5-6-13(17-11-12)18-7-9-19-10-8-18;10-8-1-2-9(11-7-8)12-3-5-13-6-4-12/h5-6,11H,7-10H2,1-4H3;1-2,7H,3-6H2 |
| InChIKey | ZKVWCEFYABGAIJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|