C21H20N4O5 — CID 162150119
6,7-dimethoxy-4-[1-(3-methoxyphenyl)pyrazol-4-yl]cinnoline;formic acid (PubChem CID 162150119) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is 6,7-dimethoxy-4-[1-(3-methoxyphenyl)pyrazol-4-yl]cinnoline;formic acid.
| Compound Name | 6,7-dimethoxy-4-[1-(3-methoxyphenyl)pyrazol-4-yl]cinnoline;formic acid |
|---|---|
| PubChem CID | 162150119 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 6,7-dimethoxy-4-[1-(3-methoxyphenyl)pyrazol-4-yl]cinnoline;formic acid |
| SMILES | COc1cccc(-n2cc(-c3cnnc4cc(OC)c(OC)cc34)cn2)c1.O=CO |
| InChI | InChI=1S/C20H18N4O3.CH2O2/c1-25-15-6-4-5-14(7-15)24-12-13(10-22-24)17-11-21-23-18-9-20(27-3)19(26-2)8-16(17)18;2-1-3/h4-12H,1-3H3;1H,(H,2,3) |
| InChIKey | ZLCAAQBDPXTIKK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|