C18H16F2N4O2 — CID 59009061
4-[6-(3,3-difluoroazetidin-1-yl)-3-pyridinyl]-6,7-dimethoxycinnoline (PubChem CID 59009061) has the molecular formula C18H16F2N4O2 and a molecular weight of 358.35 g/mol. Its IUPAC name is 4-[6-(3,3-difluoroazetidin-1-yl)-3-pyridinyl]-6,7-dimethoxycinnoline.
| Compound Name | 4-[6-(3,3-difluoroazetidin-1-yl)-3-pyridinyl]-6,7-dimethoxycinnoline |
|---|---|
| PubChem CID | 59009061 |
| Molecular Formula | C18H16F2N4O2 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 4-[6-(3,3-difluoroazetidin-1-yl)-3-pyridinyl]-6,7-dimethoxycinnoline |
| SMILES | COc1cc2nncc(-c3ccc(N4CC(F)(F)C4)nc3)c2cc1OC |
| InChI | InChI=1S/C18H16F2N4O2/c1-25-15-5-12-13(8-22-23-14(12)6-16(15)26-2)11-3-4-17(21-7-11)24-9-18(19,20)10-24/h3-8H,9-10H2,1-2H3 |
| InChIKey | DZKAYRFPFJHYKS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |