About azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne
azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne (PubChem CID 162154046) has the molecular formula C8H14N6O
and a molecular weight of 210.24 g/mol. Its IUPAC name is azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne.
Molecular Properties
| Compound Name | azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne |
| PubChem CID | 162154046 |
| Molecular Formula | C8H14N6O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne |
| SMILES | C#CC.CN=[N+]=[N-].Cn1cc(CO)nn1 |
| InChI | InChI=1S/C4H7N3O.C3H4.CH3N3/c1-7-2-4(3-8)5-6-7;1-3-2;1-3-4-2/h2,8H,3H2,1H3;1H,2H3;1H3 |
| InChIKey | ZLOWPDVDCPLHOD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne?
The IUPAC name of azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne (CID 162154046) is azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne.
What is the SMILES notation for azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne?
The canonical SMILES for azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne is C#CC.CN=[N+]=[N-].Cn1cc(CO)nn1.
What is the InChIKey of azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne?
The InChIKey is ZLOWPDVDCPLHOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O.C3H4.CH3N3/c1-7-2-4(3-8)5-6-7;1-3-2;1-3-4-2/h2,8H,3H2,1H3;1H,2H3;1H3.
What are the key properties of azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne?
azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne has a molecular weight of 210.24 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azidomethane;(1-methyltriazol-4-yl)methanol;prop-1-yne is sourced from PubChem (CID 162154046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).