About 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane
5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane (PubChem CID 162154814) has the molecular formula C16H24Cl2N2O2Sn
and a molecular weight of 466.00 g/mol. Its IUPAC name is 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane.
Molecular Properties
| Compound Name | 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane |
| PubChem CID | 162154814 |
| Molecular Formula | C16H24Cl2N2O2Sn |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane |
| SMILES | C.COc1cc([Sn](C)(C)C)c(Cl)cn1.COc1ccc(Cl)cn1 |
| InChI | InChI=1S/C6H6ClNO.C6H5ClNO.CH4.3CH3.Sn/c2*1-9-6-3-2-5(7)4-8-6;;;;;/h2-4H,1H3;3-4H,1H3;1H4;3*1H3; |
| InChIKey | ZLRKZPHWXRAROB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane?
The IUPAC name of 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane (CID 162154814) is 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane.
What is the SMILES notation for 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane?
The canonical SMILES for 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane is C.COc1cc([Sn](C)(C)C)c(Cl)cn1.COc1ccc(Cl)cn1.
What is the InChIKey of 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane?
The InChIKey is ZLRKZPHWXRAROB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO.C6H5ClNO.CH4.3CH3.Sn/c2*1-9-6-3-2-5(7)4-8-6;;;;;/h2-4H,1H3;3-4H,1H3;1H4;3*1H3;.
What are the key properties of 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane?
5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane has a molecular weight of 466.00 g/mol, XLogP of 4.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methoxypyridine;(5-chloro-2-methoxy-4-pyridinyl)-trimethylstannane;methane is sourced from PubChem (CID 162154814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).