C17H29N3 — CID 162156839
ethane;2-(piperidin-4-ylmethyl)-1H-benzimidazole (PubChem CID 162156839) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is ethane;2-(piperidin-4-ylmethyl)-1H-benzimidazole.
| Compound Name | ethane;2-(piperidin-4-ylmethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 162156839 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | ethane;2-(piperidin-4-ylmethyl)-1H-benzimidazole |
| SMILES | CC.CC.c1ccc2[nH]c(CC3CCNCC3)nc2c1 |
| InChI | InChI=1S/C13H17N3.2C2H6/c1-2-4-12-11(3-1)15-13(16-12)9-10-5-7-14-8-6-10;2*1-2/h1-4,10,14H,5-9H2,(H,15,16);2*1-2H3 |
| InChIKey | ZLYAOOILNDALED-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |