C14H21ClN4 — CID 71642448
N-methyl-N-(piperidin-4-ylmethyl)-1H-benzimidazol-2-amine;hydrochloride (PubChem CID 71642448) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is N-methyl-N-(piperidin-4-ylmethyl)-1H-benzimidazol-2-amine;hydrochloride.
| Compound Name | N-methyl-N-(piperidin-4-ylmethyl)-1H-benzimidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71642448 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-methyl-N-(piperidin-4-ylmethyl)-1H-benzimidazol-2-amine;hydrochloride |
| SMILES | CN(CC1CCNCC1)c1nc2ccccc2[nH]1.Cl |
| InChI | InChI=1S/C14H20N4.ClH/c1-18(10-11-6-8-15-9-7-11)14-16-12-4-2-3-5-13(12)17-14;/h2-5,11,15H,6-10H2,1H3,(H,16,17);1H |
| InChIKey | IIGTWNPOTGUURU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |