C14H25NO6S — CID 162157432
tert-butyl (3S)-4-(cyclopentylamino)-3-methyl-4-oxobutanoate;sulfur trioxide (PubChem CID 162157432) has the molecular formula C14H25NO6S and a molecular weight of 335.42 g/mol. Its IUPAC name is tert-butyl (3S)-4-(cyclopentylamino)-3-methyl-4-oxobutanoate;sulfur trioxide.
| Compound Name | tert-butyl (3S)-4-(cyclopentylamino)-3-methyl-4-oxobutanoate;sulfur trioxide |
|---|---|
| PubChem CID | 162157432 |
| Molecular Formula | C14H25NO6S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | tert-butyl (3S)-4-(cyclopentylamino)-3-methyl-4-oxobutanoate;sulfur trioxide |
| SMILES | C[C@@H](CC(=O)OC(C)(C)C)C(=O)NC1CCCC1.O=S(=O)=O |
| InChI | InChI=1S/C14H25NO3.O3S/c1-10(9-12(16)18-14(2,3)4)13(17)15-11-7-5-6-8-11;1-4(2)3/h10-11H,5-9H2,1-4H3,(H,15,17);/t10-;/m0./s1 |
| InChIKey | ZMACATHFKXBJQS-PPHPATTJSA-N |
| XLogP | 1.41 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |