C14H20N6 — CID 162160212
5-propan-2-ylpyrazin-2-amine;5-prop-1-en-2-ylpyrazin-2-amine (PubChem CID 162160212) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 5-propan-2-ylpyrazin-2-amine;5-prop-1-en-2-ylpyrazin-2-amine.
| Compound Name | 5-propan-2-ylpyrazin-2-amine;5-prop-1-en-2-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 162160212 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 5-propan-2-ylpyrazin-2-amine;5-prop-1-en-2-ylpyrazin-2-amine |
| SMILES | C=C(C)c1cnc(N)cn1.CC(C)c1cnc(N)cn1 |
| InChI | InChI=1S/C7H11N3.C7H9N3/c2*1-5(2)6-3-10-7(8)4-9-6/h3-5H,1-2H3,(H2,8,10);3-4H,1H2,2H3,(H2,8,10) |
| InChIKey | ZMJITWJJURZHQF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |