About methoxycarbonyl methyl carbonate;triiodovanadium
methoxycarbonyl methyl carbonate;triiodovanadium (PubChem CID 162163746) has the molecular formula C4H6I3O5V
and a molecular weight of 565.74 g/mol. Its IUPAC name is methoxycarbonyl methyl carbonate;triiodovanadium.
Molecular Properties
| Compound Name | methoxycarbonyl methyl carbonate;triiodovanadium |
| PubChem CID | 162163746 |
| Molecular Formula | C4H6I3O5V |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.68 |
| IUPAC Name | methoxycarbonyl methyl carbonate;triiodovanadium |
| SMILES | COC(=O)OC(=O)OC.I[V](I)I |
| InChI | InChI=1S/C4H6O5.3HI.V/c1-7-3(5)9-4(6)8-2;;;;/h1-2H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | ZMVNKJNPHSKUAR-UHFFFAOYSA-K |
| XLogP | 3.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methoxycarbonyl methyl carbonate;triiodovanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxycarbonyl methyl carbonate;triiodovanadium?
The IUPAC name of methoxycarbonyl methyl carbonate;triiodovanadium (CID 162163746) is methoxycarbonyl methyl carbonate;triiodovanadium.
What is the SMILES notation for methoxycarbonyl methyl carbonate;triiodovanadium?
The canonical SMILES for methoxycarbonyl methyl carbonate;triiodovanadium is COC(=O)OC(=O)OC.I[V](I)I.
What is the InChIKey of methoxycarbonyl methyl carbonate;triiodovanadium?
The InChIKey is ZMVNKJNPHSKUAR-UHFFFAOYSA-K. The full InChI is InChI=1S/C4H6O5.3HI.V/c1-7-3(5)9-4(6)8-2;;;;/h1-2H3;3*1H;/q;;;;+3/p-3.
What are the key properties of methoxycarbonyl methyl carbonate;triiodovanadium?
methoxycarbonyl methyl carbonate;triiodovanadium has a molecular weight of 565.74 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methoxycarbonyl methyl carbonate;triiodovanadium is sourced from PubChem (CID 162163746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).