About cyclopropanecarboxylic acid;propyl propanoate
cyclopropanecarboxylic acid;propyl propanoate (PubChem CID 162163858) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is cyclopropanecarboxylic acid;propyl propanoate.
Molecular Properties
| Compound Name | cyclopropanecarboxylic acid;propyl propanoate |
| PubChem CID | 162163858 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | cyclopropanecarboxylic acid;propyl propanoate |
| SMILES | CCCOC(=O)CC.O=C(O)C1CC1 |
| InChI | InChI=1S/C6H12O2.C4H6O2/c1-3-5-8-6(7)4-2;5-4(6)3-1-2-3/h3-5H2,1-2H3;3H,1-2H2,(H,5,6) |
| InChIKey | ZMVXVXYJRSLRDH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropanecarboxylic acid;propyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanecarboxylic acid;propyl propanoate?
The IUPAC name of cyclopropanecarboxylic acid;propyl propanoate (CID 162163858) is cyclopropanecarboxylic acid;propyl propanoate.
What is the SMILES notation for cyclopropanecarboxylic acid;propyl propanoate?
The canonical SMILES for cyclopropanecarboxylic acid;propyl propanoate is CCCOC(=O)CC.O=C(O)C1CC1.
What is the InChIKey of cyclopropanecarboxylic acid;propyl propanoate?
The InChIKey is ZMVXVXYJRSLRDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C4H6O2/c1-3-5-8-6(7)4-2;5-4(6)3-1-2-3/h3-5H2,1-2H3;3H,1-2H2,(H,5,6).
What are the key properties of cyclopropanecarboxylic acid;propyl propanoate?
cyclopropanecarboxylic acid;propyl propanoate has a molecular weight of 202.25 g/mol, XLogP of 1.83, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanecarboxylic acid;propyl propanoate is sourced from PubChem (CID 162163858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).