C15H26O4 — CID 177308451
trans-(1R,2R)-2-(5-propanoyloxypentyl)cyclohexane-1-carboxylic acid (PubChem CID 177308451) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is trans-(1R,2R)-2-(5-propanoyloxypentyl)cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-(5-propanoyloxypentyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 177308451 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | trans-(1R,2R)-2-(5-propanoyloxypentyl)cyclohexane-1-carboxylic acid |
| SMILES | CCC(=O)OCCCCC[C@H]1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C15H26O4/c1-2-14(16)19-11-7-3-4-8-12-9-5-6-10-13(12)15(17)18/h12-13H,2-11H2,1H3,(H,17,18)/t12-,13+/m0/s1 |
| InChIKey | SLMSHONKWNNGJK-QWHCGFSZSA-N |
| XLogP | 3.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|