C11H21O4P — CID 162164576
(1R,3S,4R)-7-dimethylphosphoryloxy-1-(methoxymethyl)-3-methyl-2-oxabicyclo[2.2.1]heptane (PubChem CID 162164576) has the molecular formula C11H21O4P and a molecular weight of 248.26 g/mol. Its IUPAC name is (1R,3S,4R)-7-dimethylphosphoryloxy-1-(methoxymethyl)-3-methyl-2-oxabicyclo[2.2.1]heptane.
| Compound Name | (1R,3S,4R)-7-dimethylphosphoryloxy-1-(methoxymethyl)-3-methyl-2-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 162164576 |
| Molecular Formula | C11H21O4P |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (1R,3S,4R)-7-dimethylphosphoryloxy-1-(methoxymethyl)-3-methyl-2-oxabicyclo[2.2.1]heptane |
| SMILES | COC[C@]12CC[C@@H](C1OP(C)(C)=O)[C@H](C)O2 |
| InChI | InChI=1S/C11H21O4P/c1-8-9-5-6-11(14-8,7-13-2)10(9)15-16(3,4)12/h8-10H,5-7H2,1-4H3/t8-,9+,10?,11+/m0/s1 |
| InChIKey | LKXWYOXZVMJOPT-FPTZPQHFSA-N |
| XLogP | 2.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|