C24H21F3N4O6Y-2 — CID 162169425
4-[[3-[3-[1-cyanoethyl(methanidyl)amino]-2-(methylideneamino)-3-oxopropyl]-1H-indol-5-yl]oxy]benzoic acid;trifluoro(hydroperoxy)methane;yttrium (PubChem CID 162169425) has the molecular formula C24H21F3N4O6Y-2 and a molecular weight of 607.35 g/mol. Its IUPAC name is 4-[[3-[3-[1-cyanoethyl(methanidyl)amino]-2-(methylideneamino)-3-oxopropyl]-1H-indol-5-yl]oxy]benzoic acid;trifluoro(hydroperoxy)methane;yttrium.
| Compound Name | 4-[[3-[3-[1-cyanoethyl(methanidyl)amino]-2-(methylideneamino)-3-oxopropyl]-1H-indol-5-yl]oxy]benzoic acid;trifluoro(hydroperoxy)methane;yttrium |
|---|---|
| PubChem CID | 162169425 |
| Molecular Formula | C24H21F3N4O6Y-2 |
| Molecular Weight | 607.35 g/mol |
| Exact Mass | 607.05 |
| IUPAC Name | 4-[[3-[3-[1-cyanoethyl(methanidyl)amino]-2-(methylideneamino)-3-oxopropyl]-1H-indol-5-yl]oxy]benzoic acid;trifluoro(hydroperoxy)methane;yttrium |
| SMILES | C=NC(Cc1c[nH]c2ccc(Oc3ccc(C(=O)O)cc3)cc12)C(=O)N([CH2-])C([CH2-])C#N.OOC(F)(F)F.[Y] |
| InChI | InChI=1S/C23H20N4O4.CHF3O2.Y/c1-14(12-24)27(3)22(28)21(25-2)10-16-13-26-20-9-8-18(11-19(16)20)31-17-6-4-15(5-7-17)23(29)30;2-1(3,4)6-5;/h4-9,11,13-14,21,26H,1-3,10H2,(H,29,30);5H;/q-2;; |
| InChIKey | FLQCFMAKQLDKRM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 148.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|