C30H43Br2F2IN2O2 — CID 162172199
4-(4-bromo-3-fluorophenyl)-4-methoxypiperidine;4-(4-bromo-3-fluorophenyl)-4-methoxy-1-propan-2-ylpiperidine;2-iodopropane (PubChem CID 162172199) has the molecular formula C30H43Br2F2IN2O2 and a molecular weight of 788.39 g/mol. Its IUPAC name is 4-(4-bromo-3-fluorophenyl)-4-methoxypiperidine;4-(4-bromo-3-fluorophenyl)-4-methoxy-1-propan-2-ylpiperidine;2-iodopropane.
| Compound Name | 4-(4-bromo-3-fluorophenyl)-4-methoxypiperidine;4-(4-bromo-3-fluorophenyl)-4-methoxy-1-propan-2-ylpiperidine;2-iodopropane |
|---|---|
| PubChem CID | 162172199 |
| Molecular Formula | C30H43Br2F2IN2O2 |
| Molecular Weight | 788.39 g/mol |
| Exact Mass | 786.07 |
| IUPAC Name | 4-(4-bromo-3-fluorophenyl)-4-methoxypiperidine;4-(4-bromo-3-fluorophenyl)-4-methoxy-1-propan-2-ylpiperidine;2-iodopropane |
| SMILES | CC(C)I.COC1(c2ccc(Br)c(F)c2)CCN(C(C)C)CC1.COC1(c2ccc(Br)c(F)c2)CCNCC1 |
| InChI | InChI=1S/C15H21BrFNO.C12H15BrFNO.C3H7I/c1-11(2)18-8-6-15(19-3,7-9-18)12-4-5-13(16)14(17)10-12;1-16-12(4-6-15-7-5-12)9-2-3-10(13)11(14)8-9;1-3(2)4/h4-5,10-11H,6-9H2,1-3H3;2-3,8,15H,4-7H2,1H3;3H,1-2H3 |
| InChIKey | ZNYAOSSLSZHBCM-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.39 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|