C20H23Br2N — CID 172840002
4,4-bis(4-bromophenyl)-1-propan-2-ylpiperidine (PubChem CID 172840002) has the molecular formula C20H23Br2N and a molecular weight of 437.22 g/mol. Its IUPAC name is 4,4-bis(4-bromophenyl)-1-propan-2-ylpiperidine.
| Compound Name | 4,4-bis(4-bromophenyl)-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 172840002 |
| Molecular Formula | C20H23Br2N |
| Molecular Weight | 437.22 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 4,4-bis(4-bromophenyl)-1-propan-2-ylpiperidine |
| SMILES | CC(C)N1CCC(c2ccc(Br)cc2)(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H23Br2N/c1-15(2)23-13-11-20(12-14-23,16-3-7-18(21)8-4-16)17-5-9-19(22)10-6-17/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | WQYTXHLFMXRZJX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.22 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |