C17H28BrN3 — CID 61415917
4-(aminomethyl)-N-[(4-bromophenyl)methyl]-N-methyl-1-propan-2-ylpiperidin-4-amine (PubChem CID 61415917) has the molecular formula C17H28BrN3 and a molecular weight of 354.34 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(4-bromophenyl)methyl]-N-methyl-1-propan-2-ylpiperidin-4-amine.
| Compound Name | 4-(aminomethyl)-N-[(4-bromophenyl)methyl]-N-methyl-1-propan-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 61415917 |
| Molecular Formula | C17H28BrN3 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 4-(aminomethyl)-N-[(4-bromophenyl)methyl]-N-methyl-1-propan-2-ylpiperidin-4-amine |
| SMILES | CC(C)N1CCC(CN)(N(C)Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C17H28BrN3/c1-14(2)21-10-8-17(13-19,9-11-21)20(3)12-15-4-6-16(18)7-5-15/h4-7,14H,8-13,19H2,1-3H3 |
| InChIKey | KWQGUHULNNKUKI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |