C16H28ClN3S — CID 65078125
4-(aminomethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-1-propan-2-ylazepan-4-amine (PubChem CID 65078125) has the molecular formula C16H28ClN3S and a molecular weight of 329.94 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-1-propan-2-ylazepan-4-amine.
| Compound Name | 4-(aminomethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-1-propan-2-ylazepan-4-amine |
|---|---|
| PubChem CID | 65078125 |
| Molecular Formula | C16H28ClN3S |
| Molecular Weight | 329.94 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-(aminomethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-1-propan-2-ylazepan-4-amine |
| SMILES | CC(C)N1CCCC(CN)(N(C)Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C16H28ClN3S/c1-13(2)20-9-4-7-16(12-18,8-10-20)19(3)11-14-5-6-15(17)21-14/h5-6,13H,4,7-12,18H2,1-3H3 |
| InChIKey | BQFLHDPMUMASQQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.94 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |