C42H35Br4IN2 — CID 162173008
2,7-dibromo-9,9-dimethyl-10H-acridine;2,7-dibromo-9,9-dimethyl-10-phenylacridine;iodobenzene (PubChem CID 162173008) has the molecular formula C42H35Br4IN2 and a molecular weight of 1014.28 g/mol. Its IUPAC name is 2,7-dibromo-9,9-dimethyl-10H-acridine;2,7-dibromo-9,9-dimethyl-10-phenylacridine;iodobenzene.
| Compound Name | 2,7-dibromo-9,9-dimethyl-10H-acridine;2,7-dibromo-9,9-dimethyl-10-phenylacridine;iodobenzene |
|---|---|
| PubChem CID | 162173008 |
| Molecular Formula | C42H35Br4IN2 |
| Molecular Weight | 1014.28 g/mol |
| Exact Mass | 1009.86 |
| IUPAC Name | 2,7-dibromo-9,9-dimethyl-10H-acridine;2,7-dibromo-9,9-dimethyl-10-phenylacridine;iodobenzene |
| SMILES | CC1(C)c2cc(Br)ccc2N(c2ccccc2)c2ccc(Br)cc21.CC1(C)c2cc(Br)ccc2Nc2ccc(Br)cc21.Ic1ccccc1 |
| InChI | InChI=1S/C21H17Br2N.C15H13Br2N.C6H5I/c1-21(2)17-12-14(22)8-10-19(17)24(16-6-4-3-5-7-16)20-11-9-15(23)13-18(20)21;1-15(2)11-7-9(16)3-5-13(11)18-14-6-4-10(17)8-12(14)15;7-6-4-2-1-3-5-6/h3-13H,1-2H3;3-8,18H,1-2H3;1-5H |
| InChIKey | ZOAOTJURUOBOMU-UHFFFAOYSA-N |
| XLogP | 15.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.28 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|