C26H26FN3 — CID 162176179
5-(3-fluorophenyl)-3-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-7H-cyclopenta[b]pyridine (PubChem CID 162176179) has the molecular formula C26H26FN3 and a molecular weight of 399.51 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-3-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-7H-cyclopenta[b]pyridine.
| Compound Name | 5-(3-fluorophenyl)-3-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-7H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 162176179 |
| Molecular Formula | C26H26FN3 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 5-(3-fluorophenyl)-3-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-7H-cyclopenta[b]pyridine |
| SMILES | CN1CCN(Cc2ccc(-c3cnc4c(c3)C(c3cccc(F)c3)=CC4)cc2)CC1 |
| InChI | InChI=1S/C26H26FN3/c1-29-11-13-30(14-12-29)18-19-5-7-20(8-6-19)22-16-25-24(9-10-26(25)28-17-22)21-3-2-4-23(27)15-21/h2-9,15-17H,10-14,18H2,1H3 |
| InChIKey | ZOKUSTNRNMLNSI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |