C25H24ClN3 — CID 165015583
5-(3-chlorophenyl)-3-[4-(piperazin-1-ylmethyl)phenyl]-7H-cyclopenta[b]pyridine (PubChem CID 165015583) has the molecular formula C25H24ClN3 and a molecular weight of 401.94 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3-[4-(piperazin-1-ylmethyl)phenyl]-7H-cyclopenta[b]pyridine.
| Compound Name | 5-(3-chlorophenyl)-3-[4-(piperazin-1-ylmethyl)phenyl]-7H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 165015583 |
| Molecular Formula | C25H24ClN3 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 5-(3-chlorophenyl)-3-[4-(piperazin-1-ylmethyl)phenyl]-7H-cyclopenta[b]pyridine |
| SMILES | Clc1cccc(C2=CCc3ncc(-c4ccc(CN5CCNCC5)cc4)cc32)c1 |
| InChI | InChI=1S/C25H24ClN3/c26-22-3-1-2-20(14-22)23-8-9-25-24(23)15-21(16-28-25)19-6-4-18(5-7-19)17-29-12-10-27-11-13-29/h1-8,14-16,27H,9-13,17H2 |
| InChIKey | HSVMZNCEUWGNPR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |