C22H36Cl2N4O3S2 — CID 162176748
2-amino-6-chloro-1H-pyridine-4-thione;6-chloro-4-[(3S)-oxolan-3-yl]sulfanylpyridin-2-amine;ethoxyethane (PubChem CID 162176748) has the molecular formula C22H36Cl2N4O3S2 and a molecular weight of 539.60 g/mol. Its IUPAC name is 2-amino-6-chloro-1H-pyridine-4-thione;6-chloro-4-[(3S)-oxolan-3-yl]sulfanylpyridin-2-amine;ethoxyethane.
| Compound Name | 2-amino-6-chloro-1H-pyridine-4-thione;6-chloro-4-[(3S)-oxolan-3-yl]sulfanylpyridin-2-amine;ethoxyethane |
|---|---|
| PubChem CID | 162176748 |
| Molecular Formula | C22H36Cl2N4O3S2 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 2-amino-6-chloro-1H-pyridine-4-thione;6-chloro-4-[(3S)-oxolan-3-yl]sulfanylpyridin-2-amine;ethoxyethane |
| SMILES | CCOCC.CCOCC.Nc1cc(=S)cc(Cl)[nH]1.Nc1cc(S[C@H]2CCOC2)cc(Cl)n1 |
| InChI | InChI=1S/C9H11ClN2OS.C5H5ClN2S.2C4H10O/c10-8-3-7(4-9(11)12-8)14-6-1-2-13-5-6;6-4-1-3(9)2-5(7)8-4;2*1-3-5-4-2/h3-4,6H,1-2,5H2,(H2,11,12);1-2H,(H3,7,8,9);2*3-4H2,1-2H3/t6-;;;/m0.../s1 |
| InChIKey | ZOMKCJUQRRDNOF-GSUNZCPGSA-N |
| XLogP | 6.26 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|