C8H10ClN3OS — CID 126988373
4-chloro-6-(oxolan-3-ylsulfanyl)pyrimidin-2-amine (PubChem CID 126988373) has the molecular formula C8H10ClN3OS and a molecular weight of 231.71 g/mol. Its IUPAC name is 4-chloro-6-(oxolan-3-ylsulfanyl)pyrimidin-2-amine.
| Compound Name | 4-chloro-6-(oxolan-3-ylsulfanyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 126988373 |
| Molecular Formula | C8H10ClN3OS |
| Molecular Weight | 231.71 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 4-chloro-6-(oxolan-3-ylsulfanyl)pyrimidin-2-amine |
| SMILES | Nc1nc(Cl)cc(SC2CCOC2)n1 |
| InChI | InChI=1S/C8H10ClN3OS/c9-6-3-7(12-8(10)11-6)14-5-1-2-13-4-5/h3,5H,1-2,4H2,(H2,10,11,12) |
| InChIKey | VOEFJUNSZOPINW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.71 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |