C12H20N4OS — CID 80890105
6-(oxan-4-ylsulfanyl)-4-N-propylpyrimidine-2,4-diamine (PubChem CID 80890105) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is 6-(oxan-4-ylsulfanyl)-4-N-propylpyrimidine-2,4-diamine.
| Compound Name | 6-(oxan-4-ylsulfanyl)-4-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80890105 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 6-(oxan-4-ylsulfanyl)-4-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1cc(SC2CCOCC2)nc(N)n1 |
| InChI | InChI=1S/C12H20N4OS/c1-2-5-14-10-8-11(16-12(13)15-10)18-9-3-6-17-7-4-9/h8-9H,2-7H2,1H3,(H3,13,14,15,16) |
| InChIKey | GPOAOIMFJLRHEB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |