C11H14N4S2 — CID 80887611
4-N-propyl-6-thiophen-2-ylsulfanylpyrimidine-2,4-diamine (PubChem CID 80887611) has the molecular formula C11H14N4S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 4-N-propyl-6-thiophen-2-ylsulfanylpyrimidine-2,4-diamine.
| Compound Name | 4-N-propyl-6-thiophen-2-ylsulfanylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80887611 |
| Molecular Formula | C11H14N4S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-N-propyl-6-thiophen-2-ylsulfanylpyrimidine-2,4-diamine |
| SMILES | CCCNc1cc(Sc2cccs2)nc(N)n1 |
| InChI | InChI=1S/C11H14N4S2/c1-2-5-13-8-7-9(15-11(12)14-8)17-10-4-3-6-16-10/h3-4,6-7H,2,5H2,1H3,(H3,12,13,14,15) |
| InChIKey | MBBDCPRFFAEQLH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |