C49H94 — CID 162179995
[(Z)-2,5-dimethylhex-3-en-3-yl]cyclopropane;2,5-dimethylhex-3-yne;(E)-3-ethyl-2,5-dimethylhex-3-ene;(E)-5-methyl-3-propan-2-ylhex-2-ene;(E)-2,3,4,5-tetramethylhex-3-ene (PubChem CID 162179995) has the molecular formula C49H94 and a molecular weight of 683.29 g/mol. Its IUPAC name is [(Z)-2,5-dimethylhex-3-en-3-yl]cyclopropane;2,5-dimethylhex-3-yne;(E)-3-ethyl-2,5-dimethylhex-3-ene;(E)-5-methyl-3-propan-2-ylhex-2-ene;(E)-2,3,4,5-tetramethylhex-3-ene.
| Compound Name | [(Z)-2,5-dimethylhex-3-en-3-yl]cyclopropane;2,5-dimethylhex-3-yne;(E)-3-ethyl-2,5-dimethylhex-3-ene;(E)-5-methyl-3-propan-2-ylhex-2-ene;(E)-2,3,4,5-tetramethylhex-3-ene |
|---|---|
| PubChem CID | 162179995 |
| Molecular Formula | C49H94 |
| Molecular Weight | 683.29 g/mol |
| Exact Mass | 682.74 |
| IUPAC Name | [(Z)-2,5-dimethylhex-3-en-3-yl]cyclopropane;2,5-dimethylhex-3-yne;(E)-3-ethyl-2,5-dimethylhex-3-ene;(E)-5-methyl-3-propan-2-ylhex-2-ene;(E)-2,3,4,5-tetramethylhex-3-ene |
| SMILES | C/C(=C(/C)C(C)C)C(C)C.C/C=C(\CC(C)C)C(C)C.CC(C)/C=C(/C(C)C)C1CC1.CC(C)C#CC(C)C.CC/C(=C\C(C)C)C(C)C |
| InChI | InChI=1S/C11H20.3C10H20.C8H14/c1-8(2)7-11(9(3)4)10-5-6-10;1-7(2)9(5)10(6)8(3)4;2*1-6-10(9(4)5)7-8(2)3;1-7(2)5-6-8(3)4/h7-10H,5-6H2,1-4H3;7-8H,1-6H3;7-9H,6H2,1-5H3;6,8-9H,7H2,1-5H3;7-8H,1-4H3/b11-7-;10-9+;10-7+;10-6+; |
| InChIKey | ZOWVTKNXWLFEKS-JEEMFYGMSA-N |
| XLogP | 16.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.29 |
| LogP ≤ 5 | 16.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|