C10H10BCl2MnO6 — CID 162182418
CID 162182418 (PubChem CID 162182418) has the molecular formula C10H10BCl2MnO6 and a molecular weight of 364.85 g/mol.
| Compound Name | CID 162182418 |
|---|---|
| PubChem CID | 162182418 |
| Molecular Formula | C10H10BCl2MnO6 |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | — |
| SMILES | Cl[Mn]Cl.O=COc1cc(C(=O)O)cc(C(=O)O)c1.[3H][B]C |
| InChI | InChI=1S/C9H6O6.CH4B.2ClH.Mn/c10-4-15-7-2-5(8(11)12)1-6(3-7)9(13)14;1-2;;;/h1-4H,(H,11,12)(H,13,14);2H,1H3;2*1H;/q;;;;+2/p-2/i;2T;;; |
| InChIKey | ZIQOLLQINKTFOY-DWKCSKCVSA-L |
| XLogP | 1.93 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|