C25H20O10 — CID 159615570
3-(3,5-diformyloxyphenyl)-5-methylbenzoic acid;3-formyloxy-5-methylbenzoic acid (PubChem CID 159615570) has the molecular formula C25H20O10 and a molecular weight of 480.43 g/mol. Its IUPAC name is 3-(3,5-diformyloxyphenyl)-5-methylbenzoic acid;3-formyloxy-5-methylbenzoic acid.
| Compound Name | 3-(3,5-diformyloxyphenyl)-5-methylbenzoic acid;3-formyloxy-5-methylbenzoic acid |
|---|---|
| PubChem CID | 159615570 |
| Molecular Formula | C25H20O10 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 3-(3,5-diformyloxyphenyl)-5-methylbenzoic acid;3-formyloxy-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(-c2cc(OC=O)cc(OC=O)c2)c1.Cc1cc(OC=O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C16H12O6.C9H8O4/c1-10-2-11(4-13(3-10)16(19)20)12-5-14(21-8-17)7-15(6-12)22-9-18;1-6-2-7(9(11)12)4-8(3-6)13-5-10/h2-9H,1H3,(H,19,20);2-5H,1H3,(H,11,12) |
| InChIKey | MNFXSJYVDMMHCF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|