C5H9CuO3-3 — CID 162190471
copper;pentane-1,1,1-triolate (PubChem CID 162190471) has the molecular formula C5H9CuO3-3 and a molecular weight of 180.67 g/mol. Its IUPAC name is copper;pentane-1,1,1-triolate.
| Compound Name | copper;pentane-1,1,1-triolate |
|---|---|
| PubChem CID | 162190471 |
| Molecular Formula | C5H9CuO3-3 |
| Molecular Weight | 180.67 g/mol |
| Exact Mass | 179.99 |
| IUPAC Name | copper;pentane-1,1,1-triolate |
| SMILES | CCCCC([O-])([O-])[O-].[Cu] |
| InChI | InChI=1S/C5H9O3.Cu/c1-2-3-4-5(6,7)8;/h2-4H2,1H3;/q-3; |
| InChIKey | MTQCJBWTVKNOMH-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.67 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|