carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate

C19H29NO4 — CID 162192039

IUPACcarbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate
SMILESCCCCN(c1ccccc1)C(C(=O)OC(C)C)C(C)C.O=C=O
InChIInChI=1S/C18H29NO2.CO2/c1-6-7-13-19(16-11-9-8-10-12-16)17(14(2)3)18(20)21-15(4)5;2-1-3/h8-12,14-15,17H,6-7,13H2,1-5H3;
InChIKeyZQKWNGUQHNKITG-UHFFFAOYSA-N
MW335.44 g/mol
LogP3.69
Rot. Bonds8

About carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate

carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate (PubChem CID 162192039) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate.

Molecular Properties

Compound Namecarbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate
PubChem CID162192039
Molecular FormulaC19H29NO4
Molecular Weight335.44 g/mol
Exact Mass335.21
IUPAC Namecarbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate
SMILESCCCCN(c1ccccc1)C(C(=O)OC(C)C)C(C)C.O=C=O
InChIInChI=1S/C18H29NO2.CO2/c1-6-7-13-19(16-11-9-8-10-12-16)17(14(2)3)18(20)21-15(4)5;2-1-3/h8-12,14-15,17H,6-7,13H2,1-5H3;
InChIKeyZQKWNGUQHNKITG-UHFFFAOYSA-N
XLogP3.69
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.44
LogP ≤ 53.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate?
The IUPAC name of carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate (CID 162192039) is carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate.
What is the SMILES notation for carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate?
The canonical SMILES for carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate is CCCCN(c1ccccc1)C(C(=O)OC(C)C)C(C)C.O=C=O.
What is the InChIKey of carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate?
The InChIKey is ZQKWNGUQHNKITG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO2.CO2/c1-6-7-13-19(16-11-9-8-10-12-16)17(14(2)3)18(20)21-15(4)5;2-1-3/h8-12,14-15,17H,6-7,13H2,1-5H3;.
What are the key properties of carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate?
carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate has a molecular weight of 335.44 g/mol, XLogP of 3.69, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;propan-2-yl 2-(N-butylanilino)-3-methylbutanoate is sourced from PubChem (CID 162192039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).