C29H42N6O3S — CID 162198529
3-amino-6-[4-[[2-hydroxy-2-(4-morpholin-4-ylphenyl)ethyl]amino]piperidin-1-yl]-4-propylthieno[2,3-b]pyridine-2-carboxamide;methane (PubChem CID 162198529) has the molecular formula C29H42N6O3S and a molecular weight of 554.76 g/mol. Its IUPAC name is 3-amino-6-[4-[[2-hydroxy-2-(4-morpholin-4-ylphenyl)ethyl]amino]piperidin-1-yl]-4-propylthieno[2,3-b]pyridine-2-carboxamide;methane.
| Compound Name | 3-amino-6-[4-[[2-hydroxy-2-(4-morpholin-4-ylphenyl)ethyl]amino]piperidin-1-yl]-4-propylthieno[2,3-b]pyridine-2-carboxamide;methane |
|---|---|
| PubChem CID | 162198529 |
| Molecular Formula | C29H42N6O3S |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | 3-amino-6-[4-[[2-hydroxy-2-(4-morpholin-4-ylphenyl)ethyl]amino]piperidin-1-yl]-4-propylthieno[2,3-b]pyridine-2-carboxamide;methane |
| SMILES | C.CCCc1cc(N2CCC(NCC(O)c3ccc(N4CCOCC4)cc3)CC2)nc2sc(C(N)=O)c(N)c12 |
| InChI | InChI=1S/C28H38N6O3S.CH4/c1-2-3-19-16-23(32-28-24(19)25(29)26(38-28)27(30)36)34-10-8-20(9-11-34)31-17-22(35)18-4-6-21(7-5-18)33-12-14-37-15-13-33;/h4-7,16,20,22,31,35H,2-3,8-15,17,29H2,1H3,(H2,30,36);1H4 |
| InChIKey | ZRGQNRIJMMHMKT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|