C28H37N5O4S — CID 22269344
3-amino-6-[4-[[2-hydroxy-2-(4-morpholin-4-ylphenyl)ethyl]amino]piperidin-1-yl]-4-propylthieno[2,3-b]pyridine-2-carboxylic acid (PubChem CID 22269344) has the molecular formula C28H37N5O4S and a molecular weight of 539.70 g/mol. Its IUPAC name is 3-amino-6-[4-[[2-hydroxy-2-(4-morpholin-4-ylphenyl)ethyl]amino]piperidin-1-yl]-4-propylthieno[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 3-amino-6-[4-[[2-hydroxy-2-(4-morpholin-4-ylphenyl)ethyl]amino]piperidin-1-yl]-4-propylthieno[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 22269344 |
| Molecular Formula | C28H37N5O4S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 3-amino-6-[4-[[2-hydroxy-2-(4-morpholin-4-ylphenyl)ethyl]amino]piperidin-1-yl]-4-propylthieno[2,3-b]pyridine-2-carboxylic acid |
| SMILES | CCCc1cc(N2CCC(NCC(O)c3ccc(N4CCOCC4)cc3)CC2)nc2sc(C(=O)O)c(N)c12 |
| InChI | InChI=1S/C28H37N5O4S/c1-2-3-19-16-23(31-27-24(19)25(29)26(38-27)28(35)36)33-10-8-20(9-11-33)30-17-22(34)18-4-6-21(7-5-18)32-12-14-37-15-13-32/h4-7,16,20,22,30,34H,2-3,8-15,17,29H2,1H3,(H,35,36) |
| InChIKey | HACIQNFKZQGDJJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|