C32H36N6O6S — CID 22269101
3-amino-6-[4-[[2-hydroxy-2-[4-[(3-nitrophenyl)methylcarbamoyl]phenyl]ethyl]amino]piperidin-1-yl]-4-propylthieno[2,3-b]pyridine-2-carboxylic acid (PubChem CID 22269101) has the molecular formula C32H36N6O6S and a molecular weight of 632.74 g/mol. Its IUPAC name is 3-amino-6-[4-[[2-hydroxy-2-[4-[(3-nitrophenyl)methylcarbamoyl]phenyl]ethyl]amino]piperidin-1-yl]-4-propylthieno[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 3-amino-6-[4-[[2-hydroxy-2-[4-[(3-nitrophenyl)methylcarbamoyl]phenyl]ethyl]amino]piperidin-1-yl]-4-propylthieno[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 22269101 |
| Molecular Formula | C32H36N6O6S |
| Molecular Weight | 632.74 g/mol |
| Exact Mass | 632.24 |
| IUPAC Name | 3-amino-6-[4-[[2-hydroxy-2-[4-[(3-nitrophenyl)methylcarbamoyl]phenyl]ethyl]amino]piperidin-1-yl]-4-propylthieno[2,3-b]pyridine-2-carboxylic acid |
| SMILES | CCCc1cc(N2CCC(NCC(O)c3ccc(C(=O)NCc4cccc([N+](=O)[O-])c4)cc3)CC2)nc2sc(C(=O)O)c(N)c12 |
| InChI | InChI=1S/C32H36N6O6S/c1-2-4-22-16-26(36-31-27(22)28(33)29(45-31)32(41)42)37-13-11-23(12-14-37)34-18-25(39)20-7-9-21(10-8-20)30(40)35-17-19-5-3-6-24(15-19)38(43)44/h3,5-10,15-16,23,25,34,39H,2,4,11-14,17-18,33H2,1H3,(H,35,40)(H,41,42) |
| InChIKey | WFDUJQUNMJVPHW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 183.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.74 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|