C30H44O4 — CID 162212028
(2E,4E)-5-[(1R,4S)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal;(2E,4E)-5-[(1S,4S)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal (PubChem CID 162212028) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is (2E,4E)-5-[(1R,4S)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal;(2E,4E)-5-[(1S,4S)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal.
| Compound Name | (2E,4E)-5-[(1R,4S)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal;(2E,4E)-5-[(1S,4S)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal |
|---|---|
| PubChem CID | 162212028 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (2E,4E)-5-[(1R,4S)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal;(2E,4E)-5-[(1S,4S)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal |
| SMILES | CC1=C[C@@H](O)CC(C)(C)[C@@H]1/C=C/C(C)=C/C=O.CC1=C[C@@H](O)CC(C)(C)[C@H]1/C=C/C(C)=C/C=O |
| InChI | InChI=1S/2C15H22O2/c2*1-11(7-8-16)5-6-14-12(2)9-13(17)10-15(14,3)4/h2*5-9,13-14,17H,10H2,1-4H3/b2*6-5+,11-7+/t13-,14+;13-,14-/m11/s1 |
| InChIKey | ZSYYRHGJKVGWJX-QFRCGJAHSA-N |
| XLogP | 6.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|