C27H40O3 — CID 74835222
4-(13,13-dimethoxy-3,7,12-trimethyltrideca-1,3,5,7,9,11-hexaenyl)-3,5,5-trimethylcyclohex-2-en-1-ol (PubChem CID 74835222) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is 4-(13,13-dimethoxy-3,7,12-trimethyltrideca-1,3,5,7,9,11-hexaenyl)-3,5,5-trimethylcyclohex-2-en-1-ol.
| Compound Name | 4-(13,13-dimethoxy-3,7,12-trimethyltrideca-1,3,5,7,9,11-hexaenyl)-3,5,5-trimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 74835222 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | 4-(13,13-dimethoxy-3,7,12-trimethyltrideca-1,3,5,7,9,11-hexaenyl)-3,5,5-trimethylcyclohex-2-en-1-ol |
| SMILES | COC(OC)C(C)=CC=CC=C(C)C=CC=C(C)C=CC1C(C)=CC(O)CC1(C)C |
| InChI | InChI=1S/C27H40O3/c1-20(12-9-10-15-22(3)26(29-7)30-8)13-11-14-21(2)16-17-25-23(4)18-24(28)19-27(25,5)6/h9-18,24-26,28H,19H2,1-8H3 |
| InChIKey | WTKRQUWBONQSNT-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|