C33H54N6O4 — CID 162218023
1-[(2R,7R)-2-(4-aminobutyl)-8-methyl-4-oxo-7-(propan-2-ylcarbamoylamino)nonyl]-3-[(2R)-1-(1H-indol-3-yl)-5-oxohexan-2-yl]urea (PubChem CID 162218023) has the molecular formula C33H54N6O4 and a molecular weight of 598.83 g/mol. Its IUPAC name is 1-[(2R,7R)-2-(4-aminobutyl)-8-methyl-4-oxo-7-(propan-2-ylcarbamoylamino)nonyl]-3-[(2R)-1-(1H-indol-3-yl)-5-oxohexan-2-yl]urea.
| Compound Name | 1-[(2R,7R)-2-(4-aminobutyl)-8-methyl-4-oxo-7-(propan-2-ylcarbamoylamino)nonyl]-3-[(2R)-1-(1H-indol-3-yl)-5-oxohexan-2-yl]urea |
|---|---|
| PubChem CID | 162218023 |
| Molecular Formula | C33H54N6O4 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.42 |
| IUPAC Name | 1-[(2R,7R)-2-(4-aminobutyl)-8-methyl-4-oxo-7-(propan-2-ylcarbamoylamino)nonyl]-3-[(2R)-1-(1H-indol-3-yl)-5-oxohexan-2-yl]urea |
| SMILES | CC(=O)CC[C@H](Cc1c[nH]c2ccccc12)NC(=O)NC[C@H](CCCCN)CC(=O)CC[C@@H](NC(=O)NC(C)C)C(C)C |
| InChI | InChI=1S/C33H54N6O4/c1-22(2)30(39-33(43)37-23(3)4)16-15-28(41)18-25(10-8-9-17-34)20-36-32(42)38-27(14-13-24(5)40)19-26-21-35-31-12-7-6-11-29(26)31/h6-7,11-12,21-23,25,27,30,35H,8-10,13-20,34H2,1-5H3,(H2,36,38,42)(H2,37,39,43)/t25-,27-,30-/m1/s1 |
| InChIKey | COADQFAYUGGIJC-OGBYTVIASA-N |
| XLogP | 4.96 |
| TPSA | 158.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|