C20H28N2O3S — CID 144920983
S-ethyl 3-(1H-indol-3-yl)-2-methylpropanethioate;5-oxohexanamide (PubChem CID 144920983) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is S-ethyl 3-(1H-indol-3-yl)-2-methylpropanethioate;5-oxohexanamide.
| Compound Name | S-ethyl 3-(1H-indol-3-yl)-2-methylpropanethioate;5-oxohexanamide |
|---|---|
| PubChem CID | 144920983 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | S-ethyl 3-(1H-indol-3-yl)-2-methylpropanethioate;5-oxohexanamide |
| SMILES | CC(=O)CCCC(N)=O.CCSC(=O)C(C)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H17NOS.C6H11NO2/c1-3-17-14(16)10(2)8-11-9-15-13-7-5-4-6-12(11)13;1-5(8)3-2-4-6(7)9/h4-7,9-10,15H,3,8H2,1-2H3;2-4H2,1H3,(H2,7,9) |
| InChIKey | MQQLRDOFENFFDJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|