C26H23NO3S — CID 162219045
1-[4-methyl-5-(3-phenylpropanoyl)thiophen-2-yl]-4-phenylmethoxypyridin-2-one (PubChem CID 162219045) has the molecular formula C26H23NO3S and a molecular weight of 429.54 g/mol. Its IUPAC name is 1-[4-methyl-5-(3-phenylpropanoyl)thiophen-2-yl]-4-phenylmethoxypyridin-2-one.
| Compound Name | 1-[4-methyl-5-(3-phenylpropanoyl)thiophen-2-yl]-4-phenylmethoxypyridin-2-one |
|---|---|
| PubChem CID | 162219045 |
| Molecular Formula | C26H23NO3S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 1-[4-methyl-5-(3-phenylpropanoyl)thiophen-2-yl]-4-phenylmethoxypyridin-2-one |
| SMILES | Cc1cc(-n2ccc(OCc3ccccc3)cc2=O)sc1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C26H23NO3S/c1-19-16-25(31-26(19)23(28)13-12-20-8-4-2-5-9-20)27-15-14-22(17-24(27)29)30-18-21-10-6-3-7-11-21/h2-11,14-17H,12-13,18H2,1H3 |
| InChIKey | ZTWHWQGQYQZSAK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |