About ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate
ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate (PubChem CID 162221726) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate |
| PubChem CID | 162221726 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate |
| SMILES | CCOC(=O)NC1CCCC1CC(C)(C)C |
| InChI | InChI=1S/C13H25NO2/c1-5-16-12(15)14-11-8-6-7-10(11)9-13(2,3)4/h10-11H,5-9H2,1-4H3,(H,14,15) |
| InChIKey | FMXUNJUMORMAPV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate?
The IUPAC name of ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate (CID 162221726) is ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate.
What is the SMILES notation for ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate?
The canonical SMILES for ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate is CCOC(=O)NC1CCCC1CC(C)(C)C.
What is the InChIKey of ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate?
The InChIKey is FMXUNJUMORMAPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-5-16-12(15)14-11-8-6-7-10(11)9-13(2,3)4/h10-11H,5-9H2,1-4H3,(H,14,15).
What are the key properties of ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate?
ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate has a molecular weight of 227.35 g/mol, XLogP of 3.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[2-(2,2-dimethylpropyl)cyclopentyl]carbamate is sourced from PubChem (CID 162221726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).