C21H28N3+ — CID 162226629
1-[2,5-dimethyl-3-[(2R)-2-methyl-3-propan-2-yl-2H-imidazol-1-yl]phenyl]-2-methylpyridin-1-ium (PubChem CID 162226629) has the molecular formula C21H28N3+ and a molecular weight of 322.48 g/mol. Its IUPAC name is 1-[2,5-dimethyl-3-[(2R)-2-methyl-3-propan-2-yl-2H-imidazol-1-yl]phenyl]-2-methylpyridin-1-ium.
| Compound Name | 1-[2,5-dimethyl-3-[(2R)-2-methyl-3-propan-2-yl-2H-imidazol-1-yl]phenyl]-2-methylpyridin-1-ium |
|---|---|
| PubChem CID | 162226629 |
| Molecular Formula | C21H28N3+ |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1-[2,5-dimethyl-3-[(2R)-2-methyl-3-propan-2-yl-2H-imidazol-1-yl]phenyl]-2-methylpyridin-1-ium |
| SMILES | Cc1cc(N2C=CN(C(C)C)[C@H]2C)c(C)c(-[n+]2ccccc2C)c1 |
| InChI | InChI=1S/C21H28N3/c1-15(2)22-11-12-24(19(22)6)21-14-16(3)13-20(18(21)5)23-10-8-7-9-17(23)4/h7-15,19H,1-6H3/q+1/t19-/m1/s1 |
| InChIKey | QUEQJYAPGZERKV-LJQANCHMSA-N |
| XLogP | 4.24 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|