C31H36BCl2IN4O4 — CID 162229338
2-chloro-5-iodopyridine;(1S)-1-[3-(6-chloro-3-pyridinyl)phenyl]ethanamine;[3-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]boronic acid (PubChem CID 162229338) has the molecular formula C31H36BCl2IN4O4 and a molecular weight of 737.28 g/mol. Its IUPAC name is 2-chloro-5-iodopyridine;(1S)-1-[3-(6-chloro-3-pyridinyl)phenyl]ethanamine;[3-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]boronic acid.
| Compound Name | 2-chloro-5-iodopyridine;(1S)-1-[3-(6-chloro-3-pyridinyl)phenyl]ethanamine;[3-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 162229338 |
| Molecular Formula | C31H36BCl2IN4O4 |
| Molecular Weight | 737.28 g/mol |
| Exact Mass | 736.13 |
| IUPAC Name | 2-chloro-5-iodopyridine;(1S)-1-[3-(6-chloro-3-pyridinyl)phenyl]ethanamine;[3-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]boronic acid |
| SMILES | C[C@H](N)c1cccc(-c2ccc(Cl)nc2)c1.C[C@H](NC(=O)OC(C)(C)C)c1cccc(B(O)O)c1.Clc1ccc(I)cn1 |
| InChI | InChI=1S/C13H20BNO4.C13H13ClN2.C5H3ClIN/c1-9(15-12(16)19-13(2,3)4)10-6-5-7-11(8-10)14(17)18;1-9(15)10-3-2-4-11(7-10)12-5-6-13(14)16-8-12;6-5-2-1-4(7)3-8-5/h5-9,17-18H,1-4H3,(H,15,16);2-9H,15H2,1H3;1-3H/t2*9-;/m00./s1 |
| InChIKey | ZVEXZJDKTCUOHL-NAWJVIAPSA-N |
| XLogP | 6.71 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.28 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|