C12H14N2O6 — CID 162231419
(2,5-dioxopyrrolidin-1-yl) propanoate;1-methylpyrrole-2,5-dione (PubChem CID 162231419) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) propanoate;1-methylpyrrole-2,5-dione.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) propanoate;1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 162231419 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) propanoate;1-methylpyrrole-2,5-dione |
| SMILES | CCC(=O)ON1C(=O)CCC1=O.CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H9NO4.C5H5NO2/c1-2-7(11)12-8-5(9)3-4-6(8)10;1-6-4(7)2-3-5(6)8/h2-4H2,1H3;2-3H,1H3 |
| InChIKey | ZVMDUTDWGXQEFL-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|