C30H45N3O10 — CID 162234864
(2R)-6-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]-4-oxo-2-[3-oxo-3-[[(3S,6R)-2,6,8-trimethyl-4,7-dioxononan-3-yl]amino]propyl]hexanoic acid (PubChem CID 162234864) has the molecular formula C30H45N3O10 and a molecular weight of 607.70 g/mol. Its IUPAC name is (2R)-6-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]-4-oxo-2-[3-oxo-3-[[(3S,6R)-2,6,8-trimethyl-4,7-dioxononan-3-yl]amino]propyl]hexanoic acid.
| Compound Name | (2R)-6-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]-4-oxo-2-[3-oxo-3-[[(3S,6R)-2,6,8-trimethyl-4,7-dioxononan-3-yl]amino]propyl]hexanoic acid |
|---|---|
| PubChem CID | 162234864 |
| Molecular Formula | C30H45N3O10 |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.31 |
| IUPAC Name | (2R)-6-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]-4-oxo-2-[3-oxo-3-[[(3S,6R)-2,6,8-trimethyl-4,7-dioxononan-3-yl]amino]propyl]hexanoic acid |
| SMILES | CC(C)C(=O)[C@H](C)CC(=O)[C@@H](NC(=O)CCC(CC(=O)CCOCCNC(=O)CCN1C(=O)C=CC1=O)C(=O)O)C(C)C |
| InChI | InChI=1S/C30H45N3O10/c1-18(2)28(23(35)16-20(5)29(40)19(3)4)32-25(37)7-6-21(30(41)42)17-22(34)11-14-43-15-12-31-24(36)10-13-33-26(38)8-9-27(33)39/h8-9,18-21,28H,6-7,10-17H2,1-5H3,(H,31,36)(H,32,37)(H,41,42)/t20-,21?,28+/m1/s1 |
| InChIKey | GWQBAAPUMZQZJP-BIBGCZDTSA-N |
| XLogP | 1.23 |
| TPSA | 193.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|