C15H11N5O2S — CID 162236162
3-(benzenesulfonyl)triazolo[1,5-a]quinazolin-5-amine (PubChem CID 162236162) has the molecular formula C15H11N5O2S and a molecular weight of 325.35 g/mol. Its IUPAC name is 3-(benzenesulfonyl)triazolo[1,5-a]quinazolin-5-amine.
| Compound Name | 3-(benzenesulfonyl)triazolo[1,5-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 162236162 |
| Molecular Formula | C15H11N5O2S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 3-(benzenesulfonyl)triazolo[1,5-a]quinazolin-5-amine |
| SMILES | Nc1nc2c(S(=O)(=O)c3ccccc3)nnn2c2ccccc12 |
| InChI | InChI=1S/C15H11N5O2S/c16-13-11-8-4-5-9-12(11)20-14(17-13)15(18-19-20)23(21,22)10-6-2-1-3-7-10/h1-9H,(H2,16,17) |
| InChIKey | ZWBWWJYTKRLNBB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |