C28H26F3N5O2 — CID 162238302
8-ethyl-11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one (PubChem CID 162238302) has the molecular formula C28H26F3N5O2 and a molecular weight of 521.54 g/mol. Its IUPAC name is 8-ethyl-11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one.
| Compound Name | 8-ethyl-11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one |
|---|---|
| PubChem CID | 162238302 |
| Molecular Formula | C28H26F3N5O2 |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 8-ethyl-11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one |
| SMILES | CCn1c(=O)c2c(-c3ccc(O)c(C(F)(F)F)c3)nc3n[nH]c(C)c3c2c2ccc(N3CCCCC3)cc21 |
| InChI | InChI=1S/C28H26F3N5O2/c1-3-36-20-14-17(35-11-5-4-6-12-35)8-9-18(20)23-22-15(2)33-34-26(22)32-25(24(23)27(36)38)16-7-10-21(37)19(13-16)28(29,30)31/h7-10,13-14,37H,3-6,11-12H2,1-2H3,(H,32,33,34) |
| InChIKey | ZWIZXRDDVPGSNW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|